C27H18FN3O3S2 — CID 83278839
N-[3-[4-(4-fluoroanilino)-2,5-dioxo-1-phenylpyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 83278839) has the molecular formula C27H18FN3O3S2 and a molecular weight of 515.59 g/mol. Its IUPAC name is N-[3-[4-(4-fluoroanilino)-2,5-dioxo-1-phenylpyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[4-(4-fluoroanilino)-2,5-dioxo-1-phenylpyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 83278839 |
| Molecular Formula | C27H18FN3O3S2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | N-[3-[4-(4-fluoroanilino)-2,5-dioxo-1-phenylpyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC2=C(Nc3ccc(F)cc3)C(=O)N(c3ccccc3)C2=O)c1)c1cccs1 |
| InChI | InChI=1S/C27H18FN3O3S2/c28-17-11-13-18(14-12-17)29-23-24(27(34)31(26(23)33)20-7-2-1-3-8-20)36-21-9-4-6-19(16-21)30-25(32)22-10-5-15-35-22/h1-16,29H,(H,30,32) |
| InChIKey | JAAHBHLQKSCPSV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|