C25H22BrN3O3S2 — CID 83272752
N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 83272752) has the molecular formula C25H22BrN3O3S2 and a molecular weight of 556.51 g/mol. Its IUPAC name is N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 83272752 |
| Molecular Formula | C25H22BrN3O3S2 |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | N-[3-[4-(4-bromoanilino)-1-(2-methylpropyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | CC(C)CN1C(=O)C(Nc2ccc(Br)cc2)=C(Sc2cccc(NC(=O)c3cccs3)c2)C1=O |
| InChI | InChI=1S/C25H22BrN3O3S2/c1-15(2)14-29-24(31)21(27-17-10-8-16(26)9-11-17)22(25(29)32)34-19-6-3-5-18(13-19)28-23(30)20-7-4-12-33-20/h3-13,15,27H,14H2,1-2H3,(H,28,30) |
| InChIKey | UYSTZEFMKVWMCG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|