C29H18ClF2N3O3S — CID 83278992
3-chloro-N-[4-[4-(4-fluoroanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83278992) has the molecular formula C29H18ClF2N3O3S and a molecular weight of 562.00 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(4-fluoroanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[4-(4-fluoroanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83278992 |
| Molecular Formula | C29H18ClF2N3O3S |
| Molecular Weight | 562.00 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | 3-chloro-N-[4-[4-(4-fluoroanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC2=C(Nc3ccc(F)cc3)C(=O)N(c3ccc(F)cc3)C2=O)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H18ClF2N3O3S/c30-18-3-1-2-17(16-18)27(36)34-22-10-14-24(15-11-22)39-26-25(33-21-8-4-19(31)5-9-21)28(37)35(29(26)38)23-12-6-20(32)7-13-23/h1-16,33H,(H,34,36) |
| InChIKey | PSIGMSXCLLJHLY-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.00 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|