C31H23F2N3O4S — CID 83276081
4-fluoro-N-[4-[1-(4-fluorophenyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 83276081) has the molecular formula C31H23F2N3O4S and a molecular weight of 571.61 g/mol. Its IUPAC name is 4-fluoro-N-[4-[1-(4-fluorophenyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[1-(4-fluorophenyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 83276081 |
| Molecular Formula | C31H23F2N3O4S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 4-fluoro-N-[4-[1-(4-fluorophenyl)-4-(2-methoxy-5-methylanilino)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(C)cc1NC1=C(Sc2ccc(NC(=O)c3ccc(F)cc3)cc2)C(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C31H23F2N3O4S/c1-18-3-16-26(40-2)25(17-18)35-27-28(31(39)36(30(27)38)23-12-8-21(33)9-13-23)41-24-14-10-22(11-15-24)34-29(37)19-4-6-20(32)7-5-19/h3-17,35H,1-2H3,(H,34,37) |
| InChIKey | CZVCWENXKGLJJO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|