C28H24F3N3O3S — CID 83277820
N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide (PubChem CID 83277820) has the molecular formula C28H24F3N3O3S and a molecular weight of 539.58 g/mol. Its IUPAC name is N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 83277820 |
| Molecular Formula | C28H24F3N3O3S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | N-[4-[4-(4-methylanilino)-2,5-dioxo-1-propan-2-ylpyrrol-3-yl]sulfanylphenyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC2=C(Sc3ccc(NC(=O)c4ccc(C(F)(F)F)cc4)cc3)C(=O)N(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C28H24F3N3O3S/c1-16(2)34-26(36)23(32-20-10-4-17(3)5-11-20)24(27(34)37)38-22-14-12-21(13-15-22)33-25(35)18-6-8-19(9-7-18)28(29,30)31/h4-16,32H,1-3H3,(H,33,35) |
| InChIKey | APUQCGKCASQYFZ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|