C29H27N3O3S — CID 83277904
N-[4-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]cyclopentanecarboxamide (PubChem CID 83277904) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is N-[4-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]cyclopentanecarboxamide.
| Compound Name | N-[4-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 83277904 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[4-[4-anilino-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]cyclopentanecarboxamide |
| SMILES | Cc1ccc(N2C(=O)C(Nc3ccccc3)=C(Sc3ccc(NC(=O)C4CCCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H27N3O3S/c1-19-11-15-23(16-12-19)32-28(34)25(30-21-9-3-2-4-10-21)26(29(32)35)36-24-17-13-22(14-18-24)31-27(33)20-7-5-6-8-20/h2-4,9-18,20,30H,5-8H2,1H3,(H,31,33) |
| InChIKey | OZTWNWVGPBUZFD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|