C21H18ClNO2S — CID 1371327
(2R)-N-(5-chloro-2-methoxyphenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 1371327) has the molecular formula C21H18ClNO2S and a molecular weight of 383.90 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-methoxyphenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2R)-N-(5-chloro-2-methoxyphenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1371327 |
| Molecular Formula | C21H18ClNO2S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (2R)-N-(5-chloro-2-methoxyphenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18ClNO2S/c1-25-19-13-12-16(22)14-18(19)23-21(24)20(15-8-4-2-5-9-15)26-17-10-6-3-7-11-17/h2-14,20H,1H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | JMHXZGYCUATKFH-HXUWFJFHSA-N |
| XLogP | 5.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |