C22H22N2O3S — CID 18894417
2-(3-aminophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)-2-phenylacetamide (PubChem CID 18894417) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-(3-aminophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 18894417 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-(3-aminophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(Sc2cccc(N)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-26-17-11-12-20(27-2)19(14-17)24-22(25)21(15-7-4-3-5-8-15)28-18-10-6-9-16(23)13-18/h3-14,21H,23H2,1-2H3,(H,24,25) |
| InChIKey | CKILAWIVVJZQGL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|