C26H28N2O3S2 — CID 2932332
N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 2932332) has the molecular formula C26H28N2O3S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2932332 |
| Molecular Formula | C26H28N2O3S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=O)C(Sc3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H28N2O3S2/c1-20-16-18-28(19-17-20)33(30,31)24-14-12-22(13-15-24)27-26(29)25(21-8-4-2-5-9-21)32-23-10-6-3-7-11-23/h2-15,20,25H,16-19H2,1H3,(H,27,29) |
| InChIKey | IPDBOWBKKCRGBA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |