C24H24N2O4S2 — CID 1320672
(2R)-N-(4-morpholin-4-ylsulfonylphenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 1320672) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is (2R)-N-(4-morpholin-4-ylsulfonylphenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2R)-N-(4-morpholin-4-ylsulfonylphenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1320672 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (2R)-N-(4-morpholin-4-ylsulfonylphenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)[C@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S2/c27-24(23(19-7-3-1-4-8-19)31-21-9-5-2-6-10-21)25-20-11-13-22(14-12-20)32(28,29)26-15-17-30-18-16-26/h1-14,23H,15-18H2,(H,25,27)/t23-/m1/s1 |
| InChIKey | BXCFCXHVGYUFCG-HSZRJFAPSA-N |
| XLogP | 4.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |