C17H26N4O5S2 — CID 47038794
3-(methanesulfonamido)-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carboxamide (PubChem CID 47038794) has the molecular formula C17H26N4O5S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carboxamide.
| Compound Name | 3-(methanesulfonamido)-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 47038794 |
| Molecular Formula | C17H26N4O5S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-(methanesulfonamido)-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carboxamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C17H26N4O5S2/c1-27(23,24)19-15-5-4-10-20(13-15)17(22)18-14-6-8-16(9-7-14)28(25,26)21-11-2-3-12-21/h6-9,15,19H,2-5,10-13H2,1H3,(H,18,22) |
| InChIKey | ZFMDUZZHUPFPMG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |