C22H34N4O4S — CID 20629792
N-[3-(cyclohexylcarbamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide (PubChem CID 20629792) has the molecular formula C22H34N4O4S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[3-(cyclohexylcarbamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide.
| Compound Name | N-[3-(cyclohexylcarbamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 20629792 |
| Molecular Formula | C22H34N4O4S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[3-(cyclohexylcarbamoyl)phenyl]-4-(propan-2-ylsulfonylamino)piperidine-1-carboxamide |
| SMILES | CC(C)S(=O)(=O)NC1CCN(C(=O)Nc2cccc(C(=O)NC3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C22H34N4O4S/c1-16(2)31(29,30)25-19-11-13-26(14-12-19)22(28)24-20-10-6-7-17(15-20)21(27)23-18-8-4-3-5-9-18/h6-7,10,15-16,18-19,25H,3-5,8-9,11-14H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | WKDSCKFVJKJQFK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |