C17H25N3O2S — CID 51559955
1-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-prop-2-enylthiourea (PubChem CID 51559955) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 51559955 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[(2R)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NC[C@@H](c1ccc(OC)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-3-8-18-17(23)19-13-16(20-9-11-22-12-10-20)14-4-6-15(21-2)7-5-14/h3-7,16H,1,8-13H2,2H3,(H2,18,19,23)/t16-/m0/s1 |
| InChIKey | IHGCXICZLFUDDG-INIZCTEOSA-N |
| XLogP | 1.72 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|