C22H27N3O4S — CID 27057461
1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiourea (PubChem CID 27057461) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 27057461 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]thiourea |
| SMILES | COc1ccc([C@@H](CNC(=S)NCc2ccc3c(c2)OCO3)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27N3O4S/c1-26-18-5-3-17(4-6-18)19(25-8-10-27-11-9-25)14-24-22(30)23-13-16-2-7-20-21(12-16)29-15-28-20/h2-7,12,19H,8-11,13-15H2,1H3,(H2,23,24,30)/t19-/m1/s1 |
| InChIKey | WZMDYUQJFBSAAG-LJQANCHMSA-N |
| XLogP | 2.46 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|