C21H26FN3OS — CID 24501862
1-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea (PubChem CID 24501862) has the molecular formula C21H26FN3OS and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 24501862 |
| Molecular Formula | C21H26FN3OS |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiourea |
| SMILES | COc1ccc(C(CNC(=S)NCc2ccc(F)cc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H26FN3OS/c1-26-19-10-6-17(7-11-19)20(25-12-2-3-13-25)15-24-21(27)23-14-16-4-8-18(22)9-5-16/h4-11,20H,2-3,12-15H2,1H3,(H2,23,24,27) |
| InChIKey | PWPRAMWHPQRGOG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|