C23H29N3O3S — CID 7945140
1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]thiourea (PubChem CID 7945140) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 7945140 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]thiourea |
| SMILES | COc1ccc([C@@H](CNC(=S)NCc2ccc3c(c2)OCO3)N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-27-19-8-6-18(7-9-19)20(26-11-3-2-4-12-26)15-25-23(30)24-14-17-5-10-21-22(13-17)29-16-28-21/h5-10,13,20H,2-4,11-12,14-16H2,1H3,(H2,24,25,30)/t20-/m1/s1 |
| InChIKey | LKJFGKBWINVKLK-HXUWFJFHSA-N |
| XLogP | 3.62 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|