C29H36FN5O3 — CID 43957079
1-(3,4-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea (PubChem CID 43957079) has the molecular formula C29H36FN5O3 and a molecular weight of 521.64 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 43957079 |
| Molecular Formula | C29H36FN5O3 |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCC(c2ccc(N(C)C)cc2)N2CCN(c3ccc(F)cc3)CC2)cc1OC |
| InChI | InChI=1S/C29H36FN5O3/c1-33(2)24-10-5-21(6-11-24)26(35-17-15-34(16-18-35)25-12-7-22(30)8-13-25)20-31-29(36)32-23-9-14-27(37-3)28(19-23)38-4/h5-14,19,26H,15-18,20H2,1-4H3,(H2,31,32,36) |
| InChIKey | NCODSFUHXBFSFG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|