C24H35N5O3 — CID 43957022
1-(3,5-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]urea (PubChem CID 43957022) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 43957022 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[2-[4-(dimethylamino)phenyl]-2-(4-methylpiperazin-1-yl)ethyl]urea |
| SMILES | COc1cc(NC(=O)NCC(c2ccc(N(C)C)cc2)N2CCN(C)CC2)cc(OC)c1 |
| InChI | InChI=1S/C24H35N5O3/c1-27(2)20-8-6-18(7-9-20)23(29-12-10-28(3)11-13-29)17-25-24(30)26-19-14-21(31-4)16-22(15-19)32-5/h6-9,14-16,23H,10-13,17H2,1-5H3,(H2,25,26,30) |
| InChIKey | ZFTRZAAITUIJBK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|