C24H29N3O3 — CID 16802050
N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 16802050) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 16802050 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN1CCCc2cc(C(CNC(=O)c3ccc4c(c3)OCO4)N3CCCC3)ccc21 |
| InChI | InChI=1S/C24H29N3O3/c1-26-10-4-5-17-13-18(6-8-20(17)26)21(27-11-2-3-12-27)15-25-24(28)19-7-9-22-23(14-19)30-16-29-22/h6-9,13-14,21H,2-5,10-12,15-16H2,1H3,(H,25,28) |
| InChIKey | TZRWMHOXFPFPNK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|