C25H33N3O — CID 16802048
3,5-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzamide (PubChem CID 16802048) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 16802048 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 3,5-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(c2ccc3c(c2)CCCN3C)N2CCCC2)c1 |
| InChI | InChI=1S/C25H33N3O/c1-18-13-19(2)15-22(14-18)25(29)26-17-24(28-11-4-5-12-28)21-8-9-23-20(16-21)7-6-10-27(23)3/h8-9,13-16,24H,4-7,10-12,17H2,1-3H3,(H,26,29) |
| InChIKey | BAVLVLLIEQUDBK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|