C26H32N4O4 — CID 40948017
N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]oxamide (PubChem CID 40948017) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 40948017 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-pyrrolidin-1-ylethyl]oxamide |
| SMILES | CN1CCCc2cc([C@@H](CNC(=O)C(=O)NCc3ccc4c(c3)OCO4)N3CCCC3)ccc21 |
| InChI | InChI=1S/C26H32N4O4/c1-29-10-4-5-19-14-20(7-8-21(19)29)22(30-11-2-3-12-30)16-28-26(32)25(31)27-15-18-6-9-23-24(13-18)34-17-33-23/h6-9,13-14,22H,2-5,10-12,15-17H2,1H3,(H,27,31)(H,28,32)/t22-/m1/s1 |
| InChIKey | DAUVRUZMRXYWRV-JOCHJYFZSA-N |
| XLogP | 2.37 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|