C13H10F2N2O3 — CID 110700006
5-acetamido-N-(2,6-difluorophenyl)furan-2-carboxamide (PubChem CID 110700006) has the molecular formula C13H10F2N2O3 and a molecular weight of 280.23 g/mol. Its IUPAC name is 5-acetamido-N-(2,6-difluorophenyl)furan-2-carboxamide.
| Compound Name | 5-acetamido-N-(2,6-difluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110700006 |
| Molecular Formula | C13H10F2N2O3 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-acetamido-N-(2,6-difluorophenyl)furan-2-carboxamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2c(F)cccc2F)o1 |
| InChI | InChI=1S/C13H10F2N2O3/c1-7(18)16-11-6-5-10(20-11)13(19)17-12-8(14)3-2-4-9(12)15/h2-6H,1H3,(H,16,18)(H,17,19) |
| InChIKey | NUVYMKSRLRXJHA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |