C20H20N2O4S2 — CID 46575958
N-[3-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethoxy]phenyl]furan-2-carboxamide (PubChem CID 46575958) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[3-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46575958 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-[3-[2-oxo-2-[2-(thiophen-2-ylmethylsulfanyl)ethylamino]ethoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccco2)c1)NCCSCc1cccs1 |
| InChI | InChI=1S/C20H20N2O4S2/c23-19(21-8-11-27-14-17-6-3-10-28-17)13-26-16-5-1-4-15(12-16)22-20(24)18-7-2-9-25-18/h1-7,9-10,12H,8,11,13-14H2,(H,21,23)(H,22,24) |
| InChIKey | PFGCHZHCOJNDCT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|