C19H24ClN3O4 — CID 119462625
N-[3-[2-oxo-2-(piperidin-3-ylmethylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride (PubChem CID 119462625) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(piperidin-3-ylmethylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[2-oxo-2-(piperidin-3-ylmethylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119462625 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[3-[2-oxo-2-(piperidin-3-ylmethylamino)ethoxy]phenyl]furan-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(COc1cccc(NC(=O)c2ccco2)c1)NCC1CCCNC1 |
| InChI | InChI=1S/C19H23N3O4.ClH/c23-18(21-12-14-4-2-8-20-11-14)13-26-16-6-1-5-15(10-16)22-19(24)17-7-3-9-25-17;/h1,3,5-7,9-10,14,20H,2,4,8,11-13H2,(H,21,23)(H,22,24);1H |
| InChIKey | MBVMSCMNZGCUIG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |