C11H15N3O3 — CID 43162394
N-(2-piperazin-1-ylacetyl)furan-2-carboxamide (PubChem CID 43162394) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(2-piperazin-1-ylacetyl)furan-2-carboxamide.
| Compound Name | N-(2-piperazin-1-ylacetyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43162394 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-(2-piperazin-1-ylacetyl)furan-2-carboxamide |
| SMILES | O=C(CN1CCNCC1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C11H15N3O3/c15-10(8-14-5-3-12-4-6-14)13-11(16)9-2-1-7-17-9/h1-2,7,12H,3-6,8H2,(H,13,15,16) |
| InChIKey | YVQDBXUFQQLLEV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |