C14H19N3O3 — CID 102681654
N-[2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)acetyl]furan-2-carboxamide (PubChem CID 102681654) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)acetyl]furan-2-carboxamide.
| Compound Name | N-[2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)acetyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 102681654 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)acetyl]furan-2-carboxamide |
| SMILES | O=C(CN1CCCC2CNCC21)NC(=O)c1ccco1 |
| InChI | InChI=1S/C14H19N3O3/c18-13(16-14(19)12-4-2-6-20-12)9-17-5-1-3-10-7-15-8-11(10)17/h2,4,6,10-11,15H,1,3,5,7-9H2,(H,16,18,19) |
| InChIKey | OHSSIGGMFUBHCZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |