C13H19N3O3 — CID 63872942
N-[2-(3,5-dimethylpiperazin-1-yl)acetyl]furan-2-carboxamide (PubChem CID 63872942) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperazin-1-yl)acetyl]furan-2-carboxamide.
| Compound Name | N-[2-(3,5-dimethylpiperazin-1-yl)acetyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 63872942 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[2-(3,5-dimethylpiperazin-1-yl)acetyl]furan-2-carboxamide |
| SMILES | CC1CN(CC(=O)NC(=O)c2ccco2)CC(C)N1 |
| InChI | InChI=1S/C13H19N3O3/c1-9-6-16(7-10(2)14-9)8-12(17)15-13(18)11-4-3-5-19-11/h3-5,9-10,14H,6-8H2,1-2H3,(H,15,17,18) |
| InChIKey | NBQOAIBARAPEOQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |