C15H20ClN3O — CID 102681612
2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-N-(3-chlorophenyl)acetamide (PubChem CID 102681612) has the molecular formula C15H20ClN3O and a molecular weight of 293.80 g/mol. Its IUPAC name is 2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 102681612 |
| Molecular Formula | C15H20ClN3O |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CN1CCCC2CNCC21)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O/c16-12-4-1-5-13(7-12)18-15(20)10-19-6-2-3-11-8-17-9-14(11)19/h1,4-5,7,11,14,17H,2-3,6,8-10H2,(H,18,20) |
| InChIKey | ZLPMCXVVXGWOQT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |