C18H24ClN3O2 — CID 95622494
N-(3-chlorophenyl)-2-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]acetamide (PubChem CID 95622494) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95622494 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(3S)-3-(pyrrolidine-1-carbonyl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@H](C(=O)N2CCCC2)C1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H24ClN3O2/c19-15-6-3-7-16(11-15)20-17(23)13-21-8-4-5-14(12-21)18(24)22-9-1-2-10-22/h3,6-7,11,14H,1-2,4-5,8-10,12-13H2,(H,20,23)/t14-/m0/s1 |
| InChIKey | YMXIXHZPZIYLJF-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |