C13H19N3O4 — CID 126615777
methyl 2-(furan-2-carbonylamino)-3-piperazin-1-ylpropanoate (PubChem CID 126615777) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 2-(furan-2-carbonylamino)-3-piperazin-1-ylpropanoate.
| Compound Name | methyl 2-(furan-2-carbonylamino)-3-piperazin-1-ylpropanoate |
|---|---|
| PubChem CID | 126615777 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 2-(furan-2-carbonylamino)-3-piperazin-1-ylpropanoate |
| SMILES | COC(=O)C(CN1CCNCC1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H19N3O4/c1-19-13(18)10(9-16-6-4-14-5-7-16)15-12(17)11-3-2-8-20-11/h2-3,8,10,14H,4-7,9H2,1H3,(H,15,17) |
| InChIKey | ALJIDOULTNYECN-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |