C15H22ClF2N3OS — CID 119392818
4-(difluoromethylsulfanyl)-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 119392818) has the molecular formula C15H22ClF2N3OS and a molecular weight of 365.88 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119392818 |
| Molecular Formula | C15H22ClF2N3OS |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H21F2N3OS.ClH/c16-15(17)22-13-4-2-12(3-5-13)14(21)19-6-1-9-20-10-7-18-8-11-20;/h2-5,15,18H,1,6-11H2,(H,19,21);1H |
| InChIKey | KLUUQKAAASSTFR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|