C24H26N2O5S2 — CID 31167855
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate (PubChem CID 31167855) has the molecular formula C24H26N2O5S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
|---|---|
| PubChem CID | 31167855 |
| Molecular Formula | C24H26N2O5S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] 4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)c2ccc(SCc3csc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O5S2/c1-3-29-20-6-8-21(9-7-20)30-13-12-25-23(27)14-31-24(28)18-4-10-22(11-5-18)33-16-19-15-32-17(2)26-19/h4-11,15H,3,12-14,16H2,1-2H3,(H,25,27) |
| InChIKey | KFSVBXNVAWNGRO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|