C27H28FN5O2 — CID 126479012
N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepine-3-carboxamide (PubChem CID 126479012) has the molecular formula C27H28FN5O2 and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepine-3-carboxamide.
| Compound Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 126479012 |
| Molecular Formula | C27H28FN5O2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,11-dihydrobenzo[b][1,4]benzodiazepine-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)c1ccc2c(c1)NC(=O)c1ccccc1N2 |
| InChI | InChI=1S/C27H28FN5O2/c28-21-7-2-4-9-25(21)33-16-14-32(15-17-33)13-5-12-29-26(34)19-10-11-23-24(18-19)31-27(35)20-6-1-3-8-22(20)30-23/h1-4,6-11,18,30H,5,12-17H2,(H,29,34)(H,31,35) |
| InChIKey | LVOYCXFJBDXYAG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|