C28H33N5O3 — CID 40773895
N'-[(2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-[(4-methylphenyl)methyl]oxamide (PubChem CID 40773895) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N'-[(2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-[(4-methylphenyl)methyl]oxamide.
| Compound Name | N'-[(2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-[(4-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 40773895 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N'-[(2S)-2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-pyridin-3-ylethyl]-N-[(4-methylphenyl)methyl]oxamide |
| SMILES | COc1ccccc1N1CCN([C@H](CNC(=O)C(=O)NCc2ccc(C)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C28H33N5O3/c1-21-9-11-22(12-10-21)18-30-27(34)28(35)31-20-25(23-6-5-13-29-19-23)33-16-14-32(15-17-33)24-7-3-4-8-26(24)36-2/h3-13,19,25H,14-18,20H2,1-2H3,(H,30,34)(H,31,35)/t25-/m1/s1 |
| InChIKey | ZXSXVZAHGXVJLM-RUZDIDTESA-N |
| XLogP | 2.69 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|