C28H35FN4O2S — CID 43957235
N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,5-dimethylbenzenesulfonamide (PubChem CID 43957235) has the molecular formula C28H35FN4O2S and a molecular weight of 510.68 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43957235 |
| Molecular Formula | C28H35FN4O2S |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCC(c2ccc(N(C)C)cc2)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C28H35FN4O2S/c1-21-5-6-22(2)28(19-21)36(34,35)30-20-27(23-7-11-25(12-8-23)31(3)4)33-17-15-32(16-18-33)26-13-9-24(29)10-14-26/h5-14,19,27,30H,15-18,20H2,1-4H3 |
| InChIKey | IMTPXUMVBDJTBO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|