C30H34N4O2S — CID 43957175
N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]naphthalene-1-sulfonamide (PubChem CID 43957175) has the molecular formula C30H34N4O2S and a molecular weight of 514.70 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]naphthalene-1-sulfonamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 43957175 |
| Molecular Formula | C30H34N4O2S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(4-phenylpiperazin-1-yl)ethyl]naphthalene-1-sulfonamide |
| SMILES | CN(C)c1ccc(C(CNS(=O)(=O)c2cccc3ccccc23)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H34N4O2S/c1-32(2)26-17-15-25(16-18-26)29(34-21-19-33(20-22-34)27-11-4-3-5-12-27)23-31-37(35,36)30-14-8-10-24-9-6-7-13-28(24)30/h3-18,29,31H,19-23H2,1-2H3 |
| InChIKey | NNZRMWLZYVHLEA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|