C16H23N3O2S3 — CID 30606723
5-methyl-N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]thiophene-2-sulfonamide (PubChem CID 30606723) has the molecular formula C16H23N3O2S3 and a molecular weight of 385.58 g/mol. Its IUPAC name is 5-methyl-N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 30606723 |
| Molecular Formula | C16H23N3O2S3 |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 5-methyl-N-[(2S)-2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](c2ccsc2)N2CCN(C)CC2)s1 |
| InChI | InChI=1S/C16H23N3O2S3/c1-13-3-4-16(23-13)24(20,21)17-11-15(14-5-10-22-12-14)19-8-6-18(2)7-9-19/h3-5,10,12,15,17H,6-9,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | BKGXMCQEQLZTCU-OAHLLOKOSA-N |
| XLogP | 2.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |