C20H29N3O2S2 — CID 16932932
N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-4-propylbenzenesulfonamide (PubChem CID 16932932) has the molecular formula C20H29N3O2S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-4-propylbenzenesulfonamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 16932932 |
| Molecular Formula | C20H29N3O2S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)NCC(c2ccsc2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O2S2/c1-3-4-17-5-7-19(8-6-17)27(24,25)21-15-20(18-9-14-26-16-18)23-12-10-22(2)11-13-23/h5-9,14,16,20-21H,3-4,10-13,15H2,1-2H3 |
| InChIKey | LQLVMILFKWHRBP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |