C18H26N2O2S3 — CID 16933255
N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 16933255) has the molecular formula C18H26N2O2S3 and a molecular weight of 398.62 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16933255 |
| Molecular Formula | C18H26N2O2S3 |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(c2ccsc2)N2CCCCCC2)s1 |
| InChI | InChI=1S/C18H26N2O2S3/c1-2-16-7-8-18(24-16)25(21,22)19-13-17(15-9-12-23-14-15)20-10-5-3-4-6-11-20/h7-9,12,14,17,19H,2-6,10-11,13H2,1H3 |
| InChIKey | ZUTLLGAMKCVTQZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |