C12H16ClNO4S2 — CID 31854379
methyl 1-[(5-chlorothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate (PubChem CID 31854379) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is methyl 1-[(5-chlorothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[(5-chlorothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 31854379 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | methyl 1-[(5-chlorothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NS(=O)(=O)c2ccc(Cl)s2)CCCCC1 |
| InChI | InChI=1S/C12H16ClNO4S2/c1-18-11(15)12(7-3-2-4-8-12)14-20(16,17)10-6-5-9(13)19-10/h5-6,14H,2-4,7-8H2,1H3 |
| InChIKey | GPLAFKFOBGYPDH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |