C15H22ClNO3S2 — CID 66930235
5-chloro-N-[1-[3-(hydroxymethyl)but-3-enyl]cyclohexyl]thiophene-2-sulfonamide (PubChem CID 66930235) has the molecular formula C15H22ClNO3S2 and a molecular weight of 363.93 g/mol. Its IUPAC name is 5-chloro-N-[1-[3-(hydroxymethyl)but-3-enyl]cyclohexyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[1-[3-(hydroxymethyl)but-3-enyl]cyclohexyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66930235 |
| Molecular Formula | C15H22ClNO3S2 |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 5-chloro-N-[1-[3-(hydroxymethyl)but-3-enyl]cyclohexyl]thiophene-2-sulfonamide |
| SMILES | C=C(CO)CCC1(NS(=O)(=O)c2ccc(Cl)s2)CCCCC1 |
| InChI | InChI=1S/C15H22ClNO3S2/c1-12(11-18)7-10-15(8-3-2-4-9-15)17-22(19,20)14-6-5-13(16)21-14/h5-6,17-18H,1-4,7-11H2 |
| InChIKey | OSRLNXINTVFKAU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|