C21H25N3O8S — CID 30782171
3,4,5-triethoxy-N'-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]benzohydrazide (PubChem CID 30782171) has the molecular formula C21H25N3O8S and a molecular weight of 479.51 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 30782171 |
| Molecular Formula | C21H25N3O8S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3,4,5-triethoxy-N'-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)sulfonyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNS(=O)(=O)c2ccc3c(c2)oc(=O)n3C)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H25N3O8S/c1-5-29-17-10-13(11-18(30-6-2)19(17)31-7-3)20(25)22-23-33(27,28)14-8-9-15-16(12-14)32-21(26)24(15)4/h8-12,23H,5-7H2,1-4H3,(H,22,25) |
| InChIKey | DDMWPHPMMMPXFM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|