C21H29N3O5 — CID 90597650
3,4,5-triethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide (PubChem CID 90597650) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 90597650 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 3,4,5-triethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2cnn(C3CCOCC3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H29N3O5/c1-4-27-18-11-15(12-19(28-5-2)20(18)29-6-3)21(25)23-16-13-22-24(14-16)17-7-9-26-10-8-17/h11-14,17H,4-10H2,1-3H3,(H,23,25) |
| InChIKey | HDZPRYFEDIIIFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |