C17H21N3O4 — CID 71810179
3,5-dimethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide (PubChem CID 71810179) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 71810179 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3,5-dimethoxy-N-[1-(oxan-4-yl)pyrazol-4-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cnn(C3CCOCC3)c2)c1 |
| InChI | InChI=1S/C17H21N3O4/c1-22-15-7-12(8-16(9-15)23-2)17(21)19-13-10-18-20(11-13)14-3-5-24-6-4-14/h7-11,14H,3-6H2,1-2H3,(H,19,21) |
| InChIKey | AXXJXWPZWIEIOK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |