C10H12F3N3O2 — CID 90597743
2,2,2-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]acetamide (PubChem CID 90597743) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 90597743 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(oxan-4-yl)pyrazol-4-yl]acetamide |
| SMILES | O=C(Nc1cnn(C2CCOCC2)c1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O2/c11-10(12,13)9(17)15-7-5-14-16(6-7)8-1-3-18-4-2-8/h5-6,8H,1-4H2,(H,15,17) |
| InChIKey | QOVXJFDUVAEZBG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |