C14H22N4O2 — CID 90597838
1-cyclopentyl-3-[1-(oxan-4-yl)pyrazol-4-yl]urea (PubChem CID 90597838) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-cyclopentyl-3-[1-(oxan-4-yl)pyrazol-4-yl]urea.
| Compound Name | 1-cyclopentyl-3-[1-(oxan-4-yl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 90597838 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-cyclopentyl-3-[1-(oxan-4-yl)pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cnn(C2CCOCC2)c1)NC1CCCC1 |
| InChI | InChI=1S/C14H22N4O2/c19-14(16-11-3-1-2-4-11)17-12-9-15-18(10-12)13-5-7-20-8-6-13/h9-11,13H,1-8H2,(H2,16,17,19) |
| InChIKey | XCRGMRHCEVNQTQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |