C19H21BrO5 — CID 7899106
2-(4-methoxyphenyl)ethyl 3-bromo-5-ethoxy-4-methoxybenzoate (PubChem CID 7899106) has the molecular formula C19H21BrO5 and a molecular weight of 409.28 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)ethyl 3-bromo-5-ethoxy-4-methoxybenzoate.
| Compound Name | 2-(4-methoxyphenyl)ethyl 3-bromo-5-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 7899106 |
| Molecular Formula | C19H21BrO5 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 2-(4-methoxyphenyl)ethyl 3-bromo-5-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCCc2ccc(OC)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C19H21BrO5/c1-4-24-17-12-14(11-16(20)18(17)23-3)19(21)25-10-9-13-5-7-15(22-2)8-6-13/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | OVSUUXVTRWYLEW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |