C17H16I2O4 — CID 10602479
ethyl 3,5-diiodo-4-[(4-methoxyphenyl)methoxy]benzoate (PubChem CID 10602479) has the molecular formula C17H16I2O4 and a molecular weight of 538.12 g/mol. Its IUPAC name is ethyl 3,5-diiodo-4-[(4-methoxyphenyl)methoxy]benzoate.
| Compound Name | ethyl 3,5-diiodo-4-[(4-methoxyphenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 10602479 |
| Molecular Formula | C17H16I2O4 |
| Molecular Weight | 538.12 g/mol |
| Exact Mass | 537.91 |
| IUPAC Name | ethyl 3,5-diiodo-4-[(4-methoxyphenyl)methoxy]benzoate |
| SMILES | CCOC(=O)c1cc(I)c(OCc2ccc(OC)cc2)c(I)c1 |
| InChI | InChI=1S/C17H16I2O4/c1-3-22-17(20)12-8-14(18)16(15(19)9-12)23-10-11-4-6-13(21-2)7-5-11/h4-9H,3,10H2,1-2H3 |
| InChIKey | FYWMFZULWUYCLE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.12 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|