C19H19F3N2O4 — CID 2265456
2-[1-(3,4-dimethoxyphenyl)ethenylamino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 2265456) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)ethenylamino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)ethenylamino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2265456 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)ethenylamino]oxy-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | C=C(NOCC(=O)Nc1cccc(C(F)(F)F)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H19F3N2O4/c1-12(13-7-8-16(26-2)17(9-13)27-3)24-28-11-18(25)23-15-6-4-5-14(10-15)19(20,21)22/h4-10,24H,1,11H2,2-3H3,(H,23,25) |
| InChIKey | APQUXNGPTDCPHC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|