C14H18N2O7 — CID 9197908
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate (PubChem CID 9197908) has the molecular formula C14H18N2O7 and a molecular weight of 326.31 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
|---|---|
| PubChem CID | 9197908 |
| Molecular Formula | C14H18N2O7 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] 2,3,4-trimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCC(N)=O)c(OC)c1OC |
| InChI | InChI=1S/C14H18N2O7/c1-20-9-5-4-8(12(21-2)13(9)22-3)14(19)23-7-11(18)16-6-10(15)17/h4-5H,6-7H2,1-3H3,(H2,15,17)(H,16,18) |
| InChIKey | ROBNTBCDVVFIKF-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |